Difference between revisions of "CPD-17271"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18762 == * common-name: ** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide * smiles...")
(Created page with "Category:metabolite == Metabolite 3-UREIDO-ISOBUTYRATE == * common-name: ** 3-(carbamoylamino)-2-methylpropanoate * smiles: ** cc(cnc(n)=o)c(=o)[o-] * inchi-key: ** phentz...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18762 ==
+
== Metabolite 3-UREIDO-ISOBUTYRATE ==
 
* common-name:
 
* common-name:
** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide
+
** 3-(carbamoylamino)-2-methylpropanoate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c(c1(c=cc=cc=1[n+](=c(c)2)[o-]))=o)
+
** cc(cnc(n)=o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** hzbjgdkeajeslm-yefhwucqsa-n
+
** phentznalbmcqd-gsvougtgsa-m
 
* molecular-weight:
 
* molecular-weight:
** 395.541
+
** 145.138
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17334]]
+
* [[RXN-11210]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide}}
+
{{#set: common-name=3-(carbamoylamino)-2-methylpropanoate}}
{{#set: inchi-key=inchikey=hzbjgdkeajeslm-yefhwucqsa-n}}
+
{{#set: inchi-key=inchikey=phentznalbmcqd-gsvougtgsa-m}}
{{#set: molecular-weight=395.541}}
+
{{#set: molecular-weight=145.138}}

Revision as of 14:56, 5 January 2021

Metabolite 3-UREIDO-ISOBUTYRATE

  • common-name:
    • 3-(carbamoylamino)-2-methylpropanoate
  • smiles:
    • cc(cnc(n)=o)c(=o)[o-]
  • inchi-key:
    • phentznalbmcqd-gsvougtgsa-m
  • molecular-weight:
    • 145.138

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality