Difference between revisions of "CPD-17278"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE == * common-name: ** d-myo-inositol (3,4)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(...")
(Created page with "Category:metabolite == Metabolite Butanoyl-ACPs == * common-name: ** a butanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9516 * RXN-9648 == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE ==
+
== Metabolite Butanoyl-ACPs ==
 
* common-name:
 
* common-name:
** d-myo-inositol (3,4)-bisphosphate
+
** a butanoyl-[acp]
* smiles:
 
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
 
* inchi-key:
 
** mckajxmrulsuki-cnwjwelysa-j
 
* molecular-weight:
 
** 336.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10960]]
+
* [[RXN-9516]]
 +
* [[RXN-9648]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10939]]
+
* [[RXN-9515]]
 +
* [[RXN-9657]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (3,4)-bisphosphate}}
+
{{#set: common-name=a butanoyl-[acp]}}
{{#set: inchi-key=inchikey=mckajxmrulsuki-cnwjwelysa-j}}
 
{{#set: molecular-weight=336.085}}
 

Revision as of 15:00, 5 January 2021

Metabolite Butanoyl-ACPs

  • common-name:
    • a butanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a butanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.