Difference between revisions of "CPD-17280"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDMETA-13652 == * common-name: ** raucaffrinoline * smiles: ** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(co)3)c(c4)5)oc(=o)c))6))))) * i...") |
(Created page with "Category:metabolite == Metabolite Tetradec-2-enoyl-ACPs == * common-name: ** a trans tetradec-2-enoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9538...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Tetradec-2-enoyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a trans tetradec-2-enoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9538]] | ||
| + | * [[RXN-9662]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9537]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trans tetradec-2-enoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 08:27, 15 March 2021
Contents
Metabolite Tetradec-2-enoyl-ACPs
- common-name:
- a trans tetradec-2-enoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a trans tetradec-2-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
