Difference between revisions of "CPD-17281"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SHIKIMATE == * common-name: ** shikimate * smiles: ** c1(=c(cc(c(o)c(o)1)o)c(=o)[o-]) * inchi-key: ** jxohggnkmltubp-hsuxutppsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite CPD-17281 == * common-name: ** a [glycerolipid]-icosatetraenoate == Reaction(s) known to consume the compound == == Reaction(s) known to...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-17281 == |
* common-name: | * common-name: | ||
− | ** | + | ** a [glycerolipid]-icosatetraenoate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16042]] |
− | * [[ | + | * [[RXN-16101]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-icosatetraenoate}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-17281
- common-name:
- a [glycerolipid]-icosatetraenoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-icosatetraenoate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.