Difference between revisions of "CPD-17312"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8092 == * common-name: ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=c...")
(Created page with "Category:metabolite == Metabolite N-Substituted-Amino-Acids == * common-name: ** an n-modified amino acid == Reaction(s) known to consume the compound == == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8092 ==
+
== Metabolite N-Substituted-Amino-Acids ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
+
** an n-modified amino acid
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** fvqgnfubhwgfcy-hjoyqdmmsa-n
 
* molecular-weight:
 
** 782.092
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8324]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8326]]
+
* [[AMINOCYL-TRNA-HYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-α-linolenoyl-phosphatidylcholine}}
+
{{#set: common-name=an n-modified amino acid}}
{{#set: inchi-key=inchikey=fvqgnfubhwgfcy-hjoyqdmmsa-n}}
 
{{#set: molecular-weight=782.092}}
 

Revision as of 18:58, 14 January 2021

Metabolite N-Substituted-Amino-Acids

  • common-name:
    • an n-modified amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality