Difference between revisions of "CPD-17312"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13435 RXN-13435] == * direction: ** left-to-right * common-name: ** palmitoyl-coa hydrolase * e...")
(Created page with "Category:metabolite == Metabolite CPD-17312 == * common-name: ** docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13435 RXN-13435] ==
+
== Metabolite CPD-17312 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** palmitoyl-coa hydrolase
+
** docosahexaenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.1.2.2 ec-3.1.2.2]
+
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-14407]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-8120]][c] '''+''' 1 [[PROTON]][c]
+
** menfzxmqsyyvrk-crcgjgbysa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ09703]]
+
** 1073.981
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-16063]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
* [[RXN-16063]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-16137]]
== External links  ==
+
== Reaction(s) of unknown directionality ==
{{#set: direction=left-to-right}}
+
{{#set: common-name=docosahexaenoyl-coa}}
{{#set: common-name=palmitoyl-coa hydrolase}}
+
{{#set: inchi-key=inchikey=menfzxmqsyyvrk-crcgjgbysa-j}}
{{#set: ec-number=ec-3.1.2.2}}
+
{{#set: molecular-weight=1073.981}}
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-17312

  • common-name:
    • docosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • menfzxmqsyyvrk-crcgjgbysa-j
  • molecular-weight:
    • 1073.981

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality