Difference between revisions of "CPD-17312"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-6-P == * common-name: ** n-acetyl-d-glucosamine 6-phosphate == Reaction(s) known to consume the compound == * PH...")
(Created page with "Category:metabolite == Metabolite CPD-17312 == * common-name: ** docosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-D-GLUCOSAMINE-6-P ==
+
== Metabolite CPD-17312 ==
 
* common-name:
 
* common-name:
** n-acetyl-d-glucosamine 6-phosphate
+
** docosahexaenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** menfzxmqsyyvrk-crcgjgbysa-j
 +
* molecular-weight:
 +
** 1073.981
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
+
* [[RXN-16063]]
* [[RXN-16425]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
+
* [[RXN-16063]]
 +
* [[RXN-16137]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-d-glucosamine 6-phosphate}}
+
{{#set: common-name=docosahexaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=menfzxmqsyyvrk-crcgjgbysa-j}}
 +
{{#set: molecular-weight=1073.981}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-17312

  • common-name:
    • docosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • menfzxmqsyyvrk-crcgjgbysa-j
  • molecular-weight:
    • 1073.981

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality