Difference between revisions of "CPD-17313"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2750 == * common-name: ** trans-3'-hydroxycotinine * smiles: ** c1(=o)(c(o)c[ch](n(c)1)c2(c=nc=cc=2)) * inchi-key: ** xokcjxzznauiqn-...") |
(Created page with "Category:metabolite == Metabolite CPD-17313 == * common-name: ** sapienoyl-coa * smiles: ** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-17313 == |
* common-name: | * common-name: | ||
| − | ** | + | ** sapienoyl-coa |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pvzuhjmomjkuef-hatlacbzsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 999.899 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16065]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sapienoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pvzuhjmomjkuef-hatlacbzsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=999.899}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-17313
- common-name:
- sapienoyl-coa
- smiles:
- cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- pvzuhjmomjkuef-hatlacbzsa-j
- molecular-weight:
- 999.899
