Difference between revisions of "CPD-17313"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02175 == * transcription-direction: ** positive * right-end-position: ** 230162 * left-end-position: ** 221781 * centisome-position: ** 40.8057...")
(Created page with "Category:metabolite == Metabolite CPD-17313 == * common-name: ** sapienoyl-coa * smiles: ** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02175 ==
+
== Metabolite CPD-17313 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** sapienoyl-coa
−
* right-end-position:
+
* smiles:
−
** 230162
+
** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 221781
+
** pvzuhjmomjkuef-hatlacbzsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 40.8057   
+
** 999.899
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-16065]]
−
* [[PEROXID-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=sapienoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=pvzuhjmomjkuef-hatlacbzsa-j}}
−
* [[RXN-14240]]
+
{{#set: molecular-weight=999.899}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15288]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17352]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8635]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=230162}}
 
−
{{#set: left-end-position=221781}}
 
−
{{#set: centisome-position=40.8057    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-17313

  • common-name:
    • sapienoyl-coa
  • smiles:
    • cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • pvzuhjmomjkuef-hatlacbzsa-j
  • molecular-weight:
    • 999.899

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-17313&oldid=137835"