Difference between revisions of "CPD-17313"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Sugar == * common-name: ** a sugar == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * SU...")
(Created page with "Category:metabolite == Metabolite CPD-17313 == * common-name: ** sapienoyl-coa * smiles: ** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Sugar ==
+
== Metabolite CPD-17313 ==
 
* common-name:
 
* common-name:
** a sugar
+
** sapienoyl-coa
 +
* smiles:
 +
** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** pvzuhjmomjkuef-hatlacbzsa-j
 +
* molecular-weight:
 +
** 999.899
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SUGAR-PHOSPHATASE-RXN]]
+
* [[RXN-16065]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sugar}}
+
{{#set: common-name=sapienoyl-coa}}
 +
{{#set: inchi-key=inchikey=pvzuhjmomjkuef-hatlacbzsa-j}}
 +
{{#set: molecular-weight=999.899}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-17313

  • common-name:
    • sapienoyl-coa
  • smiles:
    • cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • pvzuhjmomjkuef-hatlacbzsa-j
  • molecular-weight:
    • 999.899

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality