Difference between revisions of "CPD-17319"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15836 == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite CPD-17319 == * common-name: ** 1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate * smiles: ** cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cc...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-17319 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cccccccc=ccccccccc)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hhmkvxgzzuomhm-xzrwtqcasa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 700.975 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16077]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hhmkvxgzzuomhm-xzrwtqcasa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=700.975}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-17319
- common-name:
- 1-stearoyl-2-oleoyl-sn-glycerol 3-phosphate
- smiles:
- cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(cccccccc=ccccccccc)=o
- inchi-key:
- hhmkvxgzzuomhm-xzrwtqcasa-l
- molecular-weight:
- 700.975
