Difference between revisions of "CPD-17324"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Aryl-beta-D-Glucosides == * common-name: ** an aryl β-d-glucoside == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite CPD-17324 == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-17324 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxo adrenoyl-coa |
+ | * smiles: | ||
+ | ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** vmajwsswcpbijy-kpovblhlsa-j | ||
+ | * molecular-weight: | ||
+ | ** 1091.996 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-16112]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxo adrenoyl-coa}} |
+ | {{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}} | ||
+ | {{#set: molecular-weight=1091.996}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-17324
- common-name:
- 3-oxo adrenoyl-coa
- smiles:
- cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- vmajwsswcpbijy-kpovblhlsa-j
- molecular-weight:
- 1091.996