|
|
| (8 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ18316 == | + | == Metabolite CPD-17324 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** 3-oxo adrenoyl-coa |
| − | * right-end-position:
| + | * smiles: |
| − | ** 81825 | + | ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 66220 | + | ** vmajwsswcpbijy-kpovblhlsa-j |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 10.214344
| + | ** 1091.996 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN-16112]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[3.1.1.64-RXN]]
| + | {{#set: common-name=3-oxo adrenoyl-coa}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=1091.996}} |
| − | * [[ACYL-COA-HYDROLASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[CARBOXYLESTERASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[FACOAE18111Z]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[FACOAE182]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[PALMITOYL-COA-HYDROLASE-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RETINYL-PALMITATE-ESTERASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10708]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-10711]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-10767]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-12252]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-12575]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-9624]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXNQT-4366]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[PWY-5994]]
| |
| − | ** '''31''' reactions found over '''31''' reactions in the full pathway
| |
| − | * [[PWY-1121]]
| |
| − | ** '''9''' reactions found over '''19''' reactions in the full pathway
| |
| − | * [[PWY-6733]]
| |
| − | ** '''8''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY-321]]
| |
| − | ** '''3''' reactions found over '''16''' reactions in the full pathway
| |
| − | * [[PWY-735]]
| |
| − | ** '''16''' reactions found over '''19''' reactions in the full pathway
| |
| − | * [[PWY-6303]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-6857]]
| |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY3O-355]]
| |
| − | ** '''6''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-5972]]
| |
| − | ** '''4''' reactions found over '''6''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=81825}} | |
| − | {{#set: left-end-position=66220}}
| |
| − | {{#set: centisome-position=10.214344 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=14}}
| |
| − | {{#set: nb pathway associated=9}}
| |
