Difference between revisions of "CPD-17324"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...")
(Created page with "Category:metabolite == Metabolite CPD-17324 == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13717 ==
+
== Metabolite CPD-17324 ==
 
* common-name:
 
* common-name:
** l-selenocystathionine
+
** 3-oxo adrenoyl-coa
 
* smiles:
 
* smiles:
** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
+
** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** znwydqpouqrdly-whfbiakzsa-n
+
** vmajwsswcpbijy-kpovblhlsa-j
 
* molecular-weight:
 
* molecular-weight:
** 269.159
+
** 1091.996
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12729]]
+
* [[RXN-16112]]
* [[RXN-15137]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACHMSSELCYSL]]
 
* [[ACHMSSELCYSLh]]
 
* [[RXN-12728]]
 
* [[SUCHMSSELCYSL]]
 
* [[SUCHMSSELCYSLh]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-selenocystathionine}}
+
{{#set: common-name=3-oxo adrenoyl-coa}}
{{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}}
+
{{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}}
{{#set: molecular-weight=269.159}}
+
{{#set: molecular-weight=1091.996}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17324

  • common-name:
    • 3-oxo adrenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vmajwsswcpbijy-kpovblhlsa-j
  • molecular-weight:
    • 1091.996

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality