|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ12861 == | + | == Metabolite CPD-13717 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** l-selenocystathionine |
| − | * right-end-position:
| + | * smiles: |
| − | ** 193619
| + | ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 171356
| + | ** znwydqpouqrdly-whfbiakzsa-n |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 48.943195 | + | ** 269.159 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN-12729]] |
| − | == Reaction(s) associated ==
| + | * [[RXN-15137]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to produce the compound == |
| − | * [[RXN-11056]]
| + | * [[ACHMSSELCYSL]] |
| − | ** Category: [[orthology]]
| + | * [[ACHMSSELCYSLh]] |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | * [[RXN-12728]] |
| − | * [[RXN-11057]]
| + | * [[SUCHMSSELCYSL]] |
| − | ** Category: [[orthology]]
| + | * [[SUCHMSSELCYSLh]] |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * [[RXN-13064]]
| + | {{#set: common-name=l-selenocystathionine}} |
| − | ** Category: [[orthology]] | + | {{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: molecular-weight=269.159}} |
| − | * [[RXN-15029]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-17334]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-17335]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-17625]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[RXN-17627]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-8630]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-8872]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN66-146]] | |
| − | ** Category: [[orthology]] | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[RXN66-161]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN66-163]]
| |
| − | ** Category: [[orthology]] | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[RXN66-169]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN66-181]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[UNSPECIFIC-MONOOXYGENASE-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6398]]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-6992]]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7407]]
| |
| − | ** '''2''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-5451]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7466]]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-5665]]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7826]]
| |
| − | ** '''2''' reactions found over '''25''' reactions in the full pathway
| |
| − | * [[PWY66-201]]
| |
| − | ** '''3''' reactions found over '''16''' reactions in the full pathway
| |
| − | * [[PWY66-221]]
| |
| − | ** '''5''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY66-241]]
| |
| − | ** '''1''' reactions found over '''5''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=193619}} | |
| − | {{#set: left-end-position=171356}}
| |
| − | {{#set: centisome-position=48.943195 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=16}}
| |
| − | {{#set: nb pathway associated=10}}
| |
