Difference between revisions of "CPD-17324"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...") |
(Created page with "Category:metabolite == Metabolite Aryl-beta-D-Glucosides == * common-name: ** an aryl β-d-glucoside == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Aryl-beta-D-Glucosides == |
* common-name: | * common-name: | ||
| − | ** | + | ** an aryl β-d-glucoside |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an aryl β-d-glucoside}} |
| − | |||
| − | |||
Revision as of 14:54, 5 January 2021
Contents
Metabolite Aryl-beta-D-Glucosides
- common-name:
- an aryl β-d-glucoside
