Difference between revisions of "CPD-17328"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-690 == * common-name: ** adenosyl-cobyrinate a,c-diamide * smiles: ** cc5(=c%10(c(c)(ccc([o-])=o)c(cc(=o)[o-])c9(c%11(c)(c(c)(cc(n)=o...") |
(Created page with "Category:metabolite == Metabolite CPD-17328 == * common-name: ** (9z,12z,15z,18z)-tetracosatetraenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-17328 == |
* common-name: | * common-name: | ||
− | ** | + | ** (9z,12z,15z,18z)-tetracosatetraenoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** okoxeytyhdptew-gjykhrjnsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1106.066 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17112]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(9z,12z,15z,18z)-tetracosatetraenoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=okoxeytyhdptew-gjykhrjnsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1106.066}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-17328
- common-name:
- (9z,12z,15z,18z)-tetracosatetraenoyl-coa
- smiles:
- cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- okoxeytyhdptew-gjykhrjnsa-j
- molecular-weight:
- 1106.066