Difference between revisions of "CPD-17328"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.5-RXN 2.1.1.5-RXN] == * direction: ** left-to-right * common-name: ** betaine-homocysteine s-...")
 
(Created page with "Category:metabolite == Metabolite CPD-17328 == * common-name: ** (9z,12z,15z,18z)-tetracosatetraenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.5-RXN 2.1.1.5-RXN] ==
+
== Metabolite CPD-17328 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** betaine-homocysteine s-methyltransferase
+
** (9z,12z,15z,18z)-tetracosatetraenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.5 ec-2.1.1.5]
+
** cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
== Reaction formula ==
+
* inchi-key:
* 1 [[BETAINE]][c] '''+''' 1 [[HOMO-CYS]][c] '''=>''' 1 [[DIMETHYL-GLYCINE]][c] '''+''' 1 [[MET]][c]
+
** okoxeytyhdptew-gjykhrjnsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ07112]]
+
** 1106.066
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-17112]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[ADENOSYLHOMOCYSCAT-PWY]], L-methionine salvage from L-homocysteine: [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLHOMOCYSCAT-PWY ADENOSYLHOMOCYSCAT-PWY]
+
== Reaction(s) of unknown directionality ==
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: common-name=(9z,12z,15z,18z)-tetracosatetraenoyl-coa}}
* [[PWY-3661]], glycine betaine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661]
+
{{#set: inchi-key=inchikey=okoxeytyhdptew-gjykhrjnsa-j}}
** '''3''' reactions found over '''7''' reactions in the full pathway
+
{{#set: molecular-weight=1106.066}}
* [[PWY-3661-1]], glycine betaine degradation II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661-1 PWY-3661-1]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22337 22337]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02821 R02821]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=betaine-homocysteine s-methyltransferase}}
 
{{#set: ec-number=ec-2.1.1.5}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=3}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-17328

  • common-name:
    • (9z,12z,15z,18z)-tetracosatetraenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • okoxeytyhdptew-gjykhrjnsa-j
  • molecular-weight:
    • 1106.066

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality