Difference between revisions of "CPD-17328"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * smiles: ** cc1(co)(op(=o)([o-])...")
(Created page with "Category:metabolite == Metabolite Carotenoid-beta-end-group == * common-name: ** a carotenoid β-end group == Reaction(s) known to consume the compound == == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE ==
+
== Metabolite Carotenoid-beta-end-group ==
 
* common-name:
 
* common-name:
** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate
+
** a carotenoid β-end group
* smiles:
 
** cc1(co)(op(=o)([o-])op(=o)([o-])occ(o)1)
 
* inchi-key:
 
** sfrqrnjmiiuydi-uhnvwzdzsa-l
 
* molecular-weight:
 
** 276.076
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HDS]]
 
* [[RXN-15878]]
 
* [[RXN0-882]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HDS]]
+
* [[RXN-12496]]
* [[RXN0-302]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-c-methyl-d-erythritol-2,4-cyclodiphosphate}}
+
{{#set: common-name=a carotenoid β-end group}}
{{#set: inchi-key=inchikey=sfrqrnjmiiuydi-uhnvwzdzsa-l}}
 
{{#set: molecular-weight=276.076}}
 

Revision as of 13:13, 14 January 2021

Metabolite Carotenoid-beta-end-group

  • common-name:
    • a carotenoid β-end group

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality