Difference between revisions of "CPD-17329"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8815 == * common-name: ** 2,4-dihydroxybenzoate * smiles: ** cc1(=cc(=c(c=c1)c([o-])=o)o) * inchi-key: ** njesaxzanhetjv-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite CPD-17329 == * common-name: ** 3-oxo-tetracosatetraenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)co...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8815 ==
+
== Metabolite CPD-17329 ==
 
* common-name:
 
* common-name:
** 2,4-dihydroxybenzoate
+
** 3-oxo-tetracosatetraenoyl-coa
 
* smiles:
 
* smiles:
** cc1(=cc(=c(c=c1)c([o-])=o)o)
+
** cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** njesaxzanhetjv-uhfffaoysa-m
+
** wsalicwlarpulc-gjykhrjnsa-j
 
* molecular-weight:
 
* molecular-weight:
** 151.141
+
** 1120.05
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10078]]
+
* [[RXN-17109]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dihydroxybenzoate}}
+
{{#set: common-name=3-oxo-tetracosatetraenoyl-coa}}
{{#set: inchi-key=inchikey=njesaxzanhetjv-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=wsalicwlarpulc-gjykhrjnsa-j}}
{{#set: molecular-weight=151.141}}
+
{{#set: molecular-weight=1120.05}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-17329

  • common-name:
    • 3-oxo-tetracosatetraenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • wsalicwlarpulc-gjykhrjnsa-j
  • molecular-weight:
    • 1120.05

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality