Difference between revisions of "CPD-17329"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYCYTIDINE == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2)) * inchi-key: ** cktsbutuhbmzgz-shy...") |
(Created page with "Category:metabolite == Metabolite CPD0-2350 == * common-name: ** a polycistronic trna precursor == Reaction(s) known to consume the compound == * 3.1.27.9-RXN == React...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-2350 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a polycistronic trna precursor |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.27.9-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a polycistronic trna precursor}} |
| − | |||
| − | |||
Revision as of 18:52, 14 January 2021
Contents
Metabolite CPD0-2350
- common-name:
- a polycistronic trna precursor
