Difference between revisions of "CPD-17329"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22263 == * transcription-direction: ** positive * right-end-position: ** 351503 * left-end-position: ** 328434 * centisome-position: ** 56.36639...")
(Created page with "Category:metabolite == Metabolite CPD-17329 == * common-name: ** 3-oxo-tetracosatetraenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)co...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ22263 ==
+
== Metabolite CPD-17329 ==
* transcription-direction:
+
* common-name:
** positive
+
** 3-oxo-tetracosatetraenoyl-coa
* right-end-position:
+
* smiles:
** 351503
+
** cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 328434
+
** wsalicwlarpulc-gjykhrjnsa-j
* centisome-position:
+
* molecular-weight:
** 56.36639   
+
** 1120.05
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17109]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.5.1.98-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=3-oxo-tetracosatetraenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=wsalicwlarpulc-gjykhrjnsa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=1120.05}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=351503}}
 
{{#set: left-end-position=328434}}
 
{{#set: centisome-position=56.36639    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-17329

  • common-name:
    • 3-oxo-tetracosatetraenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • wsalicwlarpulc-gjykhrjnsa-j
  • molecular-weight:
    • 1120.05

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality