Difference between revisions of "CPD-17331"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06126 == * transcription-direction: ** negative * right-end-position: ** 27666 * left-end-position: ** 9727 * centisome-position: ** 11.642410...")
(Created page with "Category:metabolite == Metabolite CPD-17331 == * common-name: ** (9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06126 ==
+
== Metabolite CPD-17331 ==
* transcription-direction:
+
* common-name:
** negative
+
** (9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa
* right-end-position:
+
* smiles:
** 27666
+
** ccc=ccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 9727
+
** bnamtmvbovnnsh-afqbpcmksa-j
* centisome-position:
+
* molecular-weight:
** 11.642410   
+
** 1104.05
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16132]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.1.1.77-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=bnamtmvbovnnsh-afqbpcmksa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=1104.05}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=27666}}
 
{{#set: left-end-position=9727}}
 
{{#set: centisome-position=11.642410    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:10, 18 March 2021

Metabolite CPD-17331

  • common-name:
    • (9z,12z,15z,18z,21z)-tetracosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • bnamtmvbovnnsh-afqbpcmksa-j
  • molecular-weight:
    • 1104.05

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality