Difference between revisions of "CPD-17332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6975 RXN0-6975] == * direction: ** left-to-right * common-name: ** cytosolic dipeptidase * ec-...")
 
(Created page with "Category:metabolite == Metabolite CPD-17332 == * common-name: ** 3-oxo-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)c...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6975 RXN0-6975] ==
+
== Metabolite CPD-17332 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** cytosolic dipeptidase
+
** 3-oxo-tetracosapentaenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.4.13.18 ec-3.4.13.18]
+
** ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-13404]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[L-ASPARTATE]][c]
+
** uqpanogfyczrav-afqbpcmksa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11013]]
+
** 1118.034
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-16129]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-tetracosapentaenoyl-coa}}
== External links  ==
+
{{#set: inchi-key=inchikey=uqpanogfyczrav-afqbpcmksa-j}}
* RHEA:
+
{{#set: molecular-weight=1118.034}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=37268 37268]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=cytosolic dipeptidase}}
 
{{#set: ec-number=ec-3.4.13.18}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-17332

  • common-name:
    • 3-oxo-tetracosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • uqpanogfyczrav-afqbpcmksa-j
  • molecular-weight:
    • 1118.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality