Difference between revisions of "CPD-17332"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TREHALOSE-6P == * common-name: ** α,α-trehalose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine746 == * common-name: ** uridine746 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11843 == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TREHALOSE-6P ==
+
== Metabolite 23S-rRNA-uridine746 ==
 
* common-name:
 
* common-name:
** α,α-trehalose 6-phosphate
+
** uridine746 in 23s rrna
* smiles:
 
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
 
* inchi-key:
 
** labspybhmpdtel-lizsdcnhsa-l
 
* molecular-weight:
 
** 420.263
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TREHALOSEPHOSPHA-RXN]]
+
* [[RXN-11843]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TREHALOSE6PSYN-RXN]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α,α-trehalose 6-phosphate}}
+
{{#set: common-name=uridine746 in 23s rrna}}
{{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}}
 
{{#set: molecular-weight=420.263}}
 

Revision as of 18:56, 14 January 2021

Metabolite 23S-rRNA-uridine746

  • common-name:
    • uridine746 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality