Difference between revisions of "CPD-17346"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11153 RXN-11153] == * direction: ** left-to-right * common-name: ** l-galactono-1,4-lactone deh...")
(Created page with "Category:metabolite == Metabolite CPD-17346 == * common-name: ** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11153 RXN-11153] ==
+
== Metabolite CPD-17346 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** l-galactono-1,4-lactone dehydrogenase
+
** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
== Reaction formula ==
+
* smiles:
* 1 [[Acceptor]][c] '''+''' 1 [[CPD-330]][c] '''=>''' 1 [[ASCORBATE]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[PROTON]][c]
+
** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Gene(s) associated with this reaction  ==
+
* inchi-key:
== Pathway(s) ==
+
** puwduocpcwfefg-ygyqdceasa-j
* [[PWY-6415]], L-ascorbate biosynthesis V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6415 PWY-6415]
+
* molecular-weight:
** '''4''' reactions found over '''7''' reactions in the full pathway
+
** 1067.974
== Reconstruction information  ==
+
== Reaction(s) known to consume the compound ==
* category: [[manual]]; source: [[previous_meneco]]; tool: [[unknown-tool]]; comment: reaction added with meneco (previous version)
+
* [[RXN-16095]]
== External links  ==
+
== Reaction(s) known to produce the compound ==
{{#set: direction=left-to-right}}
+
* [[RXN-16094]]
{{#set: common-name=l-galactono-1,4-lactone dehydrogenase}}
+
== Reaction(s) of unknown directionality ==
{{#set: nb gene associated=0}}
+
{{#set: common-name=3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa}}
{{#set: nb pathway associated=1}}
+
{{#set: inchi-key=inchikey=puwduocpcwfefg-ygyqdceasa-j}}
{{#set: reconstruction category=manual}}
+
{{#set: molecular-weight=1067.974}}
{{#set: reconstruction tool=unknown-tool}}
 
{{#set: reconstruction comment=reaction added with meneco (previous version)}}
 
{{#set: reconstruction source=previous_meneco}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-17346

  • common-name:
    • 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • puwduocpcwfefg-ygyqdceasa-j
  • molecular-weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality