|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.4-RXN 3.4.21.4-RXN] == | + | == Metabolite CPD-17346 == |
| − | * direction: | + | * common-name: |
| − | ** left-to-right | + | ** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.4.21.4 ec-3.4.21.4] | + | ** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[General-Protein-Substrates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Peptides-holder]][c]
| + | ** puwduocpcwfefg-ygyqdceasa-j |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ12361]]
| + | ** 1067.974 |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN-16095]] |
| − | == Pathway(s) == | + | == Reaction(s) known to produce the compound == |
| − | == Reconstruction information ==
| + | * [[RXN-16094]] |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | == External links == | + | {{#set: common-name=3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa}} |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | {{#set: inchi-key=inchikey=puwduocpcwfefg-ygyqdceasa-j}} |
| − | * UNIPROT:
| + | {{#set: molecular-weight=1067.974}} |
| − | ** [http://www.uniprot.org/uniprot/P07477 P07477]
| |
| − | ** [http://www.uniprot.org/uniprot/P08426 P08426]
| |
| − | ** [http://www.uniprot.org/uniprot/P35051 P35051]
| |
| − | ** [http://www.uniprot.org/uniprot/P19799 P19799]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M434 Q7M434]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M435 Q7M435]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M390 Q7M390]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7LZP8 Q7LZP8]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7LZF8 Q7LZF8]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M433 Q7M433]
| |
| − | ** [http://www.uniprot.org/uniprot/P07146 P07146]
| |
| − | ** [http://www.uniprot.org/uniprot/P07478 P07478]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M3N1 Q7M3N1]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M432 Q7M432]
| |
| − | ** [http://www.uniprot.org/uniprot/P32821 P32821]
| |
| − | ** [http://www.uniprot.org/uniprot/P32822 P32822]
| |
| − | ** [http://www.uniprot.org/uniprot/P12788 P12788]
| |
| − | ** [http://www.uniprot.org/uniprot/P35050 P35050]
| |
| − | ** [http://www.uniprot.org/uniprot/Q29463 Q29463]
| |
| − | ** [http://www.uniprot.org/uniprot/P35034 P35034]
| |
| − | ** [http://www.uniprot.org/uniprot/P35031 P35031]
| |
| − | ** [http://www.uniprot.org/uniprot/P35032 P35032]
| |
| − | ** [http://www.uniprot.org/uniprot/P35033 P35033]
| |
| − | ** [http://www.uniprot.org/uniprot/P35030 P35030]
| |
| − | ** [http://www.uniprot.org/uniprot/P35035 P35035]
| |
| − | ** [http://www.uniprot.org/uniprot/P35036 P35036]
| |
| − | ** [http://www.uniprot.org/uniprot/P16049 P16049]
| |
| − | ** [http://www.uniprot.org/uniprot/Q91041 Q91041]
| |
| − | ** [http://www.uniprot.org/uniprot/P35038 P35038]
| |
| − | ** [http://www.uniprot.org/uniprot/P35041 P35041]
| |
| − | ** [http://www.uniprot.org/uniprot/P35037 P35037]
| |
| − | ** [http://www.uniprot.org/uniprot/Q92099 Q92099]
| |
| − | ** [http://www.uniprot.org/uniprot/Q27761 Q27761]
| |
| − | ** [http://www.uniprot.org/uniprot/Q90629 Q90629]
| |
| − | ** [http://www.uniprot.org/uniprot/Q90628 Q90628]
| |
| − | ** [http://www.uniprot.org/uniprot/Q90627 Q90627]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7M436 Q7M436]
| |
| − | ** [http://www.uniprot.org/uniprot/P35045 P35045]
| |
| − | ** [http://www.uniprot.org/uniprot/P00765 P00765]
| |
| − | ** [http://www.uniprot.org/uniprot/P00764 P00764]
| |
| − | ** [http://www.uniprot.org/uniprot/P06872 P06872]
| |
| − | ** [http://www.uniprot.org/uniprot/P06871 P06871]
| |
| − | ** [http://www.uniprot.org/uniprot/P00761 P00761]
| |
| − | ** [http://www.uniprot.org/uniprot/P00762 P00762]
| |
| − | ** [http://www.uniprot.org/uniprot/P00763 P00763]
| |
| − | ** [http://www.uniprot.org/uniprot/P00775 P00775]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: ec-number=ec-3.4.21.4}}
| |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=orthology}} | |
| − | {{#set: reconstruction tool=pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
| |
