Difference between revisions of "CPD-17347"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TYR-tRNAs == * common-name: ** a trnatyr == Reaction(s) known to consume the compound == * TYROSINE--TRNA-LIGASE-RXN == Reaction(s) k...")
(Created page with "Category:metabolite == Metabolite CPD-17347 == * common-name: ** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TYR-tRNAs ==
+
== Metabolite CPD-17347 ==
 
* common-name:
 
* common-name:
** a trnatyr
+
** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa
 +
* smiles:
 +
** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** mntslnsvzacncx-jpddaygwsa-j
 +
* molecular-weight:
 +
** 1069.99
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TYROSINE--TRNA-LIGASE-RXN]]
+
* [[RXN-16096]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16095]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnatyr}}
+
{{#set: common-name=(3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa}}
 +
{{#set: inchi-key=inchikey=mntslnsvzacncx-jpddaygwsa-j}}
 +
{{#set: molecular-weight=1069.99}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-17347

  • common-name:
    • (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mntslnsvzacncx-jpddaygwsa-j
  • molecular-weight:
    • 1069.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality