Difference between revisions of "CPD-17348"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15435 == * common-name: ** l-threonylcarbamoyladenylate * smiles: ** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))...")
(Created page with "Category:metabolite == Metabolite DNA-Cytosines == * common-name: ** a cytosine in dna == Reaction(s) known to consume the compound == * 2.1.1.113-RXN * DNA-CYTOSINE...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15435 ==
+
== Metabolite DNA-Cytosines ==
 
* common-name:
 
* common-name:
** l-threonylcarbamoyladenylate
+
** a cytosine in dna
* smiles:
 
** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o
 
* inchi-key:
 
** ghlupquheijrcu-dwvddhqfsa-l
 
* molecular-weight:
 
** 490.322
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14569]]
+
* [[2.1.1.113-RXN]]
* [[RXN-14570]]
+
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14569]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-threonylcarbamoyladenylate}}
+
{{#set: common-name=a cytosine in dna}}
{{#set: inchi-key=inchikey=ghlupquheijrcu-dwvddhqfsa-l}}
 
{{#set: molecular-weight=490.322}}
 

Revision as of 15:31, 5 January 2021

Metabolite DNA-Cytosines

  • common-name:
    • a cytosine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality