Difference between revisions of "CPD-17348"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16623 RXN-16623] == * direction: ** left-to-right * common-name: ** (3r,7z)-3-hydroxy-hexadec-7...")
(Created page with "Category:metabolite == Metabolite CPD-17348 == * common-name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: ** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16623 RXN-16623] ==
+
== Metabolite CPD-17348 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** (3r,7z)-3-hydroxy-hexadec-7-enoyl-[acp] dehydratase
+
** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.2.1.59 ec-4.2.1.59]
+
** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[3R-7Z-3-hydroxy-hexadec-7-enoyl-ACPs]][c] '''=>''' 1 [[2E-7Z-hexadeca-2-7-dienoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
+
** jlhullpftgligf-dbyuabgnsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ10275]]
+
** 1051.975
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-16097]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
+
* [[RXN-16096]]
** '''13''' reactions found over '''14''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
== External links  ==
+
{{#set: molecular-weight=1051.975}}
{{#set: direction=left-to-right}}
 
{{#set: common-name=(3r,7z)-3-hydroxy-hexadec-7-enoyl-[acp] dehydratase}}
 
{{#set: ec-number=ec-4.2.1.59}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-17348

  • common-name:
    • (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jlhullpftgligf-dbyuabgnsa-j
  • molecular-weight:
    • 1051.975

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality