Difference between revisions of "CPD-17355"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-332 == * common-name: ** dihydrozeatin * smiles: ** cc(co)ccnc2(=nc=nc1(=c(n=cn1)2)) * inchi-key: ** xxfactaygkkoqb-zetcqymhsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CRPB-all-trans-Retinol == * common-name: ** an all-trans retinol-[cellular-retinol-binding-protein] == Reaction(s) known to consume the c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CRPB-all-trans-Retinol == |
* common-name: | * common-name: | ||
| − | ** | + | ** an all-trans retinol-[cellular-retinol-binding-protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12581]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an all-trans retinol-[cellular-retinol-binding-protein]}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite CRPB-all-trans-Retinol
- common-name:
- an all-trans retinol-[cellular-retinol-binding-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an all-trans retinol-[cellular-retinol-binding-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
