Difference between revisions of "CPD-17370"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21322 == * transcription-direction: ** positive * right-end-position: ** 29118 * left-end-position: ** 28216 * centisome-position: ** 4.698962...")
 
(Created page with "Category:metabolite == Metabolite CPD-17370 == * common-name: ** 18-hydroxyoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21322 ==
+
== Metabolite CPD-17370 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 18-hydroxyoleoyl-coa
−
* right-end-position:
+
* smiles:
−
** 29118
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 28216
+
** mqacsuxwiyyzak-utnxwdcosa-j
−
* centisome-position:
+
* molecular-weight:
−
** 4.698962   
+
** 1043.952
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16117]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-16402]]
−
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=18-hydroxyoleoyl-coa}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=mqacsuxwiyyzak-utnxwdcosa-j}}
−
* [[ESTRADIOL-17-BETA-DEHYDROGENASE-RXN]]
+
{{#set: molecular-weight=1043.952}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[HBNOm]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RETINOL-DEHYDROGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12581]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17728]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY66-368]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY66-367]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY66-380]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6872]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7782]]
 
−
** '''11''' reactions found over '''16''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=29118}}
 
−
{{#set: left-end-position=28216}}
 
−
{{#set: centisome-position=4.698962    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-17370

  • common-name:
    • 18-hydroxyoleoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mqacsuxwiyyzak-utnxwdcosa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-17370&oldid=136649"