Difference between revisions of "CPD-17370"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05371 == * transcription-direction: ** positive * right-end-position: ** 109703 * left-end-position: ** 91128 * centisome-position: ** 18.357185...") |
(Created page with "Category:metabolite == Metabolite CPD1G-0 == * common-name: ** 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol * smiles: ** c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD1G-0 == |
| − | * | + | * common-name: |
| − | ** | + | ** 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** hepuigaczyvucd-lfikjohqsa-o |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 342.322 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN1G-121]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol}} | |
| − | + | {{#set: inchi-key=inchikey=hepuigaczyvucd-lfikjohqsa-o}} | |
| − | + | {{#set: molecular-weight=342.322}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Revision as of 20:29, 18 December 2020
Contents
Metabolite CPD1G-0
- common-name:
- 1-(2-amino-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol
- smiles:
- c(o)c2(c(c(c([n+])c(oc1(c(o)c(o)c(o)c(o)c(o)1))o2)o)o)
- inchi-key:
- hepuigaczyvucd-lfikjohqsa-o
- molecular-weight:
- 342.322
