Difference between revisions of "CPD-17371"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12018 == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)=cn1)c=2)) * inchi-key: ** jtejppkmybdemy-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite CPD0-1445 == * common-name: ** l-alanyl-l-glutamate * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** vyzagtdahuirqa-whf...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1445 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-glutamate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vyzagtdahuirqa-whfbiakzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 217.201 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6981]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-glutamate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vyzagtdahuirqa-whfbiakzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.201}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD0-1445
- common-name:
- l-alanyl-l-glutamate
- smiles:
- cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-]
- inchi-key:
- vyzagtdahuirqa-whfbiakzsa-m
- molecular-weight:
- 217.201
