Difference between revisions of "CPD-17371"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1445 == * common-name: ** l-alanyl-l-glutamate * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** vyzagtdahuirqa-whf...") |
(Created page with "Category:metabolite == Metabolite CPD-8123 == * common-name: ** moo2-molybdopterin cofactor * smiles: ** c(op([o-])(=o)[o-])c2(c1(s[mo](=o)(=o)sc=1[ch]3([ch](o2)nc4(=c(n3)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-8123 == |
* common-name: | * common-name: | ||
− | ** | + | ** moo2-molybdopterin cofactor |
* smiles: | * smiles: | ||
− | ** | + | ** c(op([o-])(=o)[o-])c2(c1(s[mo](=o)(=o)sc=1[ch]3([ch](o2)nc4(=c(n3)c(=o)nc(n)=n4)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hdajuggarufrou-jsudgwjlsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 519.251 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-8351]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8348]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=moo2-molybdopterin cofactor}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hdajuggarufrou-jsudgwjlsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=519.251}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-8123
- common-name:
- moo2-molybdopterin cofactor
- smiles:
- c(op([o-])(=o)[o-])c2(c1(s[mo](=o)(=o)sc=1[ch]3([ch](o2)nc4(=c(n3)c(=o)nc(n)=n4))))
- inchi-key:
- hdajuggarufrou-jsudgwjlsa-j
- molecular-weight:
- 519.251