Difference between revisions of "CPD-17371"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09379 == * transcription-direction: ** positive * right-end-position: ** 579885 * left-end-position: ** 573576 * centisome-position: ** 69.892296...")
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09379 ==
+
== Metabolite CPD-17371 ==
* transcription-direction:
+
* common-name:
** positive
+
** 18-hydroxylinoleoyl-coa
* right-end-position:
+
* smiles:
** 579885
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 573576
+
** hjegylshikpenr-daxvlclxsa-j
* centisome-position:
+
* molecular-weight:
** 69.892296   
+
** 1041.936
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16118]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=18-hydroxylinoleoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=1041.936}}
{{#set: right-end-position=579885}}
 
{{#set: left-end-position=573576}}
 
{{#set: centisome-position=69.892296    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17371

  • common-name:
    • 18-hydroxylinoleoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hjegylshikpenr-daxvlclxsa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality