Difference between revisions of "CPD-17371"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11528 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cc(=o)cc(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-12018 == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)=cn1)c=2)) * inchi-key: ** jtejppkmybdemy-uhfffaoysa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11528 ==
+
== Metabolite CPD-12018 ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa
+
** 5-methoxytryptamine
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
+
** coc2(c=cc1(=c(c(ccn)=cn1)c=2))
 
* inchi-key:
 
* inchi-key:
** qgjlcxxjefrwhp-jqukjzmasa-j
+
** jtejppkmybdemy-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 997.797
+
** 190.244
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10701]]
+
* [[RXN-11067]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10703]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa}}
+
{{#set: common-name=5-methoxytryptamine}}
{{#set: inchi-key=inchikey=qgjlcxxjefrwhp-jqukjzmasa-j}}
+
{{#set: inchi-key=inchikey=jtejppkmybdemy-uhfffaoysa-n}}
{{#set: molecular-weight=997.797}}
+
{{#set: molecular-weight=190.244}}

Revision as of 18:54, 14 January 2021

Metabolite CPD-12018

  • common-name:
    • 5-methoxytryptamine
  • smiles:
    • coc2(c=cc1(=c(c(ccn)=cn1)c=2))
  • inchi-key:
    • jtejppkmybdemy-uhfffaoysa-n
  • molecular-weight:
    • 190.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality