Difference between revisions of "CPD-17372"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19843 == * transcription-direction: ** negative * right-end-position: ** 134224 * left-end-position: ** 117390 * centisome-position: ** 53.616207...") |
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17372 == |
− | * | + | * common-name: |
− | ** | + | ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate |
− | * | + | * smiles: |
− | ** | + | ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o |
− | * | + | * inchi-key: |
− | ** | + | ** gfjkjlhwwzxdau-kxfgnqbasa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 450.508 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-16118]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-16117]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}} | |
− | * [[RXN- | + | {{#set: inchi-key=inchikey=gfjkjlhwwzxdau-kxfgnqbasa-l}} |
− | + | {{#set: molecular-weight=450.508}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-17372
- common-name:
- 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
- smiles:
- c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- gfjkjlhwwzxdau-kxfgnqbasa-l
- molecular-weight:
- 450.508
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-[18-hydroxyoleyl]-2-lyso-phosphatidate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.