Difference between revisions of "CPD-17372"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite eEF-2-Histidines == * common-name: ** an l-histidine-[translation elongation factor 2] == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite CPD-17372 == * common-name: ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate * smiles: ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o *...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17372 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate |
| + | * smiles: | ||
| + | ** c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o | ||
| + | * inchi-key: | ||
| + | ** gfjkjlhwwzxdau-kxfgnqbasa-l | ||
| + | * molecular-weight: | ||
| + | ** 450.508 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16118]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16117]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}} |
| + | {{#set: inchi-key=inchikey=gfjkjlhwwzxdau-kxfgnqbasa-l}} | ||
| + | {{#set: molecular-weight=450.508}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-17372
- common-name:
- 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
- smiles:
- c(o)cccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- gfjkjlhwwzxdau-kxfgnqbasa-l
- molecular-weight:
- 450.508
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-[18-hydroxyoleyl]-2-lyso-phosphatidate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
