Difference between revisions of "CPD-17372"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2338 == * common-name: ** (z)-3-ureidoacrylate peracid * smiles: ** c(nc(n)=o)=cc(=o)oo * inchi-key: ** ajfkxwqdhfykfk-uphrsurjsa-n...")
(Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2338 ==
+
== Metabolite CPD-12575 ==
 
* common-name:
 
* common-name:
** (z)-3-ureidoacrylate peracid
+
** udp-α-d-glucose
 
* smiles:
 
* smiles:
** c(nc(n)=o)=cc(=o)oo
+
** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)
 
* inchi-key:
 
* inchi-key:
** ajfkxwqdhfykfk-uphrsurjsa-n
+
** hscjrczfdfqwrp-jzmiexbbsa-l
 
* molecular-weight:
 
* molecular-weight:
** 146.102
+
** 564.289
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12894]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[RXN0-6460]]
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 +
* [[2.4.1.117-RXN]]
 +
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[GLYCOGENIN-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[RXN-12123]]
 +
* [[RXN-12125]]
 +
* [[RXN-12126]]
 +
* [[RXN-12127]]
 +
* [[RXN-12128]]
 +
* [[RXN-1223]]
 +
* [[RXN-15117]]
 +
* [[RXN-16975]]
 +
* [[RXN-4726]]
 +
* [[RXN-4733]]
 +
* [[RXN-5482]]
 +
* [[RXN-7667]]
 +
* [[RXN-7828]]
 +
* [[RXN-8228]]
 +
* [[RXN1F-461]]
 +
* [[RXN1F-462]]
 +
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 +
* [[TREHALOSE6PSYN-RXN]]
 +
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UDPGth]]
 +
* [[UG4E]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 +
* [[UGD-RXN]]
 +
* [[UGDH]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GALACTURIDYLYLTRANS-RXN]]
 +
* [[GLUC1PURIDYLTRANS-RXN]]
 +
* [[UDPGLUCEPIM-RXN]]
 +
* [[UDPGth]]
 +
* [[UG1PUT]]
 +
* [[UG4E]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(z)-3-ureidoacrylate peracid}}
+
{{#set: common-name=udp-&alpha;-d-glucose}}
{{#set: inchi-key=inchikey=ajfkxwqdhfykfk-uphrsurjsa-n}}
+
{{#set: inchi-key=inchikey=hscjrczfdfqwrp-jzmiexbbsa-l}}
{{#set: molecular-weight=146.102}}
+
{{#set: molecular-weight=564.289}}

Revision as of 15:28, 5 January 2021