Difference between revisions of "CPD-17373"

Revision as of 18:57, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-8529 ==
+== Metabolite DELTA3-ISOPENTENYL-PP ==
+* common-name:
+** isopentenyl diphosphate
 * smiles:
-** c(ssc([r2])[r1])([r4])[r3]
+** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]
-* common-name:
+* inchi-key:
-** r'c(r)s-s(r)cr'
+** nuhsrofqtuxzqq-uhfffaoysa-k
+* molecular-weight:
+** 243.069
 == Reaction(s) known to consume the compound ==
+* [[FARNESYLTRANSTRANSFERASE-RXN]]
+* [[FPPS]]
+* [[FPPSYN-RXN]]
+* [[GGPS]]
+* [[GPPS]]
+* [[GPPSYN-RXN]]
+* [[IDI]]
+* [[IPPISOM-RXN]]
+* [[RXN-10068]]
+* [[RXN-11486]]
+* [[RXN-11488]]
+* [[RXN-11963]]
+* [[RXN-8999]]
+* [[RXN-9969]]
+* [[RXN0-5180]]
+* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[THIOL-OXIDASE-RXN]]
+* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
+* [[GPPSYN-RXN]]
+* [[IDS1]]
+* [[IPPISOM-RXN]]
+* [[ISPH2-RXN]]
+* [[RXN-10068]]
+* [[RXN-11963]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=r'c(r)s-s(r)cr'}}
+{{#set: common-name=isopentenyl diphosphate}}
+{{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}
+{{#set: molecular-weight=243.069}}