Difference between revisions of "CPD-17375"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20472 == * transcription-direction: ** negative * right-end-position: ** 35450 * left-end-position: ** 16255 * centisome-position: ** 2.630161...") |
(Created page with "Category:metabolite == Metabolite CPD-17375 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol * smiles: ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccc...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17375 == |
| − | * | + | * common-name: |
| − | ** | + | ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** rcalbbvhqnuwno-osfdyrcisa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 650.978 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-16121]] |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}} | |
| − | + | {{#set: inchi-key=inchikey=rcalbbvhqnuwno-osfdyrcisa-n}} | |
| − | {{#set: | + | {{#set: molecular-weight=650.978}} |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-17375
- common-name:
- 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
- smiles:
- c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)co)=o
- inchi-key:
- rcalbbvhqnuwno-osfdyrcisa-n
- molecular-weight:
- 650.978
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
