Difference between revisions of "CPD-17382"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02262 == * transcription-direction: ** positive * right-end-position: ** 317358 * left-end-position: ** 288042 * centisome-position: ** 53.02532...")
(Created page with "Category:metabolite == Metabolite CPD-17382 == * common-name: ** (3r)-hydroxy-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02262 ==
+
== Metabolite CPD-17382 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (3r)-hydroxy-tetracosapentaenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 317358
+
** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 288042
+
** drqaurckckdinz-kpyxopptsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 53.02532   
+
** 1120.05
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16130]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
+
* [[RXN-16129]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(3r)-hydroxy-tetracosapentaenoyl-coa}}
−
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=drqaurckckdinz-kpyxopptsa-j}}
−
* [[1CMET2-PWY]]
+
{{#set: molecular-weight=1120.05}}
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5497]]
 
−
** '''10''' reactions found over '''24''' reactions in the full pathway
 
−
* [[CODH-PWY]]
 
−
** '''4''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7909]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-3841]]
 
−
** '''9''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-2201]]
 
−
** '''9''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-1722]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=317358}}
 
−
{{#set: left-end-position=288042}}
 
−
{{#set: centisome-position=53.02532    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-17382

  • common-name:
    • (3r)-hydroxy-tetracosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • drqaurckckdinz-kpyxopptsa-j
  • molecular-weight:
    • 1120.05

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-17382&oldid=136840"