Difference between revisions of "CPD-17385"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-methionyl-tRNAfmet == * common-name: ** an l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compound == * METHIONY...")
(Created page with "Category:metabolite == Metabolite CPD-17385 == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-methionyl-tRNAfmet ==
+
== Metabolite CPD-17385 ==
 
* common-name:
 
* common-name:
** an l-methionyl-[initiator trnamet]
+
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** krifzirxaaithr-kwfbmmabsa-j
 +
* molecular-weight:
 +
** 1102.034
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
+
* [[RXN-16134]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16165]]
+
* [[RXN-16132]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-methionyl-[initiator trnamet]}}
+
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
 +
{{#set: molecular-weight=1102.034}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-17385

  • common-name:
    • (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • krifzirxaaithr-kwfbmmabsa-j
  • molecular-weight:
    • 1102.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality