Difference between revisions of "CPD-17387"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18293 == * transcription-direction: ** positive * right-end-position: ** 11867 * left-end-position: ** 7222 * centisome-position: ** 1.1139835...") |
(Created page with "Category:metabolite == Metabolite CPD-17387 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17387 == |
| − | * | + | * common-name: |
| − | ** | + | ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** jjcguwrdulvwqg-drxnpijbsa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 1118.034 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-16135]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}} | |
| − | + | {{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}} | |
| − | + | {{#set: molecular-weight=1118.034}} | |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-17387
- common-name:
- (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- jjcguwrdulvwqg-drxnpijbsa-j
- molecular-weight:
- 1118.034
