Difference between revisions of "CPD-17387"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4203 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)(...") |
(Created page with "Category:metabolite == Metabolite CPD-17387 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-17387 == |
* common-name: | * common-name: | ||
− | ** | + | ** (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** jjcguwrdulvwqg-drxnpijbsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1118.034 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16135]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jjcguwrdulvwqg-drxnpijbsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1118.034}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-17387
- common-name:
- (3s)-hydroxy-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
- inchi-key:
- jjcguwrdulvwqg-drxnpijbsa-j
- molecular-weight:
- 1118.034