Difference between revisions of "CPD-17387"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8163 == * common-name: ** 1-16:0-2-18:2-digalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite CPD-12017 == * common-name: ** n-acetyl-serotonin sulfate * smiles: ** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12)) * inchi-key: ** uca...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8163 ==
+
== Metabolite CPD-12017 ==
 
* common-name:
 
* common-name:
** 1-16:0-2-18:2-digalactosyldiacylglycerol
+
** n-acetyl-serotonin sulfate
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(oc(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))coc(=o)ccccccccccccccc)=o
+
** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
 
* inchi-key:
 
* inchi-key:
** qzxmupatkglzap-gnspkctrsa-n
+
** ucajznvfrvluls-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 917.225
+
** 297.305
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8365]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11059]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-16:0-2-18:2-digalactosyldiacylglycerol}}
+
{{#set: common-name=n-acetyl-serotonin sulfate}}
{{#set: inchi-key=inchikey=qzxmupatkglzap-gnspkctrsa-n}}
+
{{#set: inchi-key=inchikey=ucajznvfrvluls-uhfffaoysa-m}}
{{#set: molecular-weight=917.225}}
+
{{#set: molecular-weight=297.305}}

Revision as of 15:26, 5 January 2021

Metabolite CPD-12017

  • common-name:
    • n-acetyl-serotonin sulfate
  • smiles:
    • cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12))
  • inchi-key:
    • ucajznvfrvluls-uhfffaoysa-m
  • molecular-weight:
    • 297.305

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality