Difference between revisions of "CPD-17388"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-2-thiouridine34 == * common-name: ** a 2-thiouridine34 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD-17388 == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-2-thiouridine34 ==
+
== Metabolite CPD-17388 ==
 
* common-name:
 
* common-name:
** a 2-thiouridine34 in trna
+
** 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** dnhdpaxpqgygij-kwfbmmabsa-j
 +
* molecular-weight:
 +
** 1116.018
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16137]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16820]]
 
* [[RXN0-2023]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-thiouridine34 in trna}}
+
{{#set: common-name=3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
 +
{{#set: inchi-key=inchikey=dnhdpaxpqgygij-kwfbmmabsa-j}}
 +
{{#set: molecular-weight=1116.018}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17388

  • common-name:
    • 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • dnhdpaxpqgygij-kwfbmmabsa-j
  • molecular-weight:
    • 1116.018

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality