Difference between revisions of "CPD-17388"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08861 == * transcription-direction: ** negative * right-end-position: ** 13432 * left-end-position: ** 12836 * centisome-position: ** 26.734983...")
(Created page with "Category:metabolite == Metabolite CPD-17388 == * common-name: ** 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ08861 ==
+
== Metabolite CPD-17388 ==
* transcription-direction:
+
* common-name:
** negative
+
** 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
* right-end-position:
+
* smiles:
** 13432
+
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 12836
+
** dnhdpaxpqgygij-kwfbmmabsa-j
* centisome-position:
+
* molecular-weight:
** 26.734983   
+
** 1116.018
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16137]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.1.26.4-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=dnhdpaxpqgygij-kwfbmmabsa-j}}
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
{{#set: molecular-weight=1116.018}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=13432}}
 
{{#set: left-end-position=12836}}
 
{{#set: centisome-position=26.734983    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17388

  • common-name:
    • 3-oxo-(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • dnhdpaxpqgygij-kwfbmmabsa-j
  • molecular-weight:
    • 1116.018

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality