Difference between revisions of "CPD-17397"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...") |
(Created page with "Category:metabolite == Metabolite Ferrohemoglobins == * common-name: ** a ferrohemoglobin == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Ferrohemoglobins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a ferrohemoglobin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11195]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a ferrohemoglobin}} |
| − | |||
| − | |||
Revision as of 08:27, 15 March 2021
Contents
Metabolite Ferrohemoglobins
- common-name:
- a ferrohemoglobin
